Structure of PDB 4y46 Chain A Binding Site BS01 |
|
|
Ligand ID | 4F2 |
InChI | InChI=1S/C22H32N6O2/c1-14(2)24-22(30)26-17-10-8-16(9-11-17)25-21-23-13-15-7-12-19(29)28(20(15)27-21)18-5-3-4-6-18/h7,12-14,16-18H,3-6,8-11H2,1-2H3,(H,23,25,27)(H2,24,26,30)/t16-,17- |
InChIKey | QJPUIIKZKMYPSK-QAQDUYKDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(C)NC(=O)NC1CCC(CC1)Nc2ncc3c(n2)N(C(=O)C=C3)C4CCCC4 | CACTVS 3.385 | CC(C)NC(=O)N[CH]1CC[CH](CC1)Nc2ncc3C=CC(=O)N(C4CCCC4)c3n2 | CACTVS 3.385 | CC(C)NC(=O)N[C@H]1CC[C@@H](CC1)Nc2ncc3C=CC(=O)N(C4CCCC4)c3n2 | ACDLabs 12.01 | C1CC(CCC1Nc4nc3c(C=CC(=O)N3C2CCCC2)cn4)NC(NC(C)C)=O |
|
Formula | C22 H32 N6 O2 |
Name | 1-{trans-4-[(8-cyclopentyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl}-3-propan-2-ylurea |
ChEMBL | CHEMBL3577877 |
DrugBank | |
ZINC |
|
PDB chain | 4y46 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|