Structure of PDB 4y14 Chain A Binding Site BS01 |
|
|
Ligand ID | C0A |
InChI | InChI=1S/C12H16BrF2N2O6PS/c1-16-11(18)10(17-25(2,22)23)6-7-3-4-8(9(13)5-7)12(14,15)24(19,20)21/h3-5,10,17H,6H2,1-2H3,(H,16,18)(H2,19,20,21)/t10-/m0/s1 |
InChIKey | GNQQLTLSVIWPPQ-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)[CH](Cc1ccc(c(Br)c1)C(F)(F)[P](O)(O)=O)N[S](C)(=O)=O | OpenEye OEToolkits 1.9.2 | CNC(=O)[C@H](Cc1ccc(c(c1)Br)C(F)(F)P(=O)(O)O)NS(=O)(=O)C | CACTVS 3.385 | CNC(=O)[C@H](Cc1ccc(c(Br)c1)C(F)(F)[P](O)(O)=O)N[S](C)(=O)=O | ACDLabs 12.01 | Brc1cc(ccc1C(F)(F)P(=O)(O)O)CC(C(=O)NC)NS(=O)(=O)C | OpenEye OEToolkits 1.9.2 | CNC(=O)C(Cc1ccc(c(c1)Br)C(F)(F)P(=O)(O)O)NS(=O)(=O)C |
|
Formula | C12 H16 Br F2 N2 O6 P S |
Name | 3-bromo-4-[difluoro(phosphono)methyl]-N-methyl-Nalpha-(methylsulfonyl)-L-phenylalaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000200599630
|
PDB chain | 4y14 Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|