Structure of PDB 4xiq Chain A Binding Site BS01 |
|
|
Ligand ID | 40Y |
InChI | InChI=1S/C20H22N2O3/c1-11-13-6-7-25-17-8-12(19(21)24)4-5-14(17)22(13)15-9-20(2,3)10-16(23)18(11)15/h4-5,8H,6-7,9-10H2,1-3H3,(H2,21,24) |
InChIKey | CXFXSTHDYJQJAP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1c2n(c3c1C(=O)CC(C3)(C)C)-c4ccc(cc4OCC2)C(=O)N | ACDLabs 12.01 | O=C(N)c3cc4OCCc1n(c2c(c1C)C(=O)CC(C2)(C)C)c4cc3 | CACTVS 3.385 | Cc1c2CCOc3cc(ccc3n2c4CC(C)(C)CC(=O)c14)C(N)=O |
|
Formula | C20 H22 N2 O3 |
Name | 8,11,11-trimethyl-9-oxo-6,7,9,10,11,12-hexahydroindolo[2,1-d][1,5]benzoxazepine-3-carboxamide |
ChEMBL | CHEMBL3403716 |
DrugBank | |
ZINC | ZINC000221484007
|
PDB chain | 4xiq Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|