Structure of PDB 4xcu Chain A Binding Site BS01 |
|
|
Ligand ID | 40M |
InChI | InChI=1S/C26H24Cl2N4O3/c1-5-21(33)30-18-8-6-7-14(2)25(18)32-26-29-13-16-11-15(9-10-17(16)31-26)22-23(27)19(34-3)12-20(35-4)24(22)28/h6-13H,5H2,1-4H3,(H,30,33)(H,29,31,32) |
InChIKey | RZCMOTRUCYNDLA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCC(=O)Nc1cccc(c1Nc2ncc3cc(ccc3n2)c4c(c(cc(c4Cl)OC)OC)Cl)C | ACDLabs 12.01 | O=C(Nc1c(c(ccc1)C)Nc3ncc2cc(ccc2n3)c4c(c(cc(c4Cl)OC)OC)Cl)CC | CACTVS 3.385 | CCC(=O)Nc1cccc(C)c1Nc2ncc3cc(ccc3n2)c4c(Cl)c(OC)cc(OC)c4Cl |
|
Formula | C26 H24 Cl2 N4 O3 |
Name | N-(2-{[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino}-3-methylphenyl)propanamide; BLU9931 bound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4xcu Chain A Residue 1002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|