Structure of PDB 4xar Chain A Binding Site BS01 |
|
|
Ligand ID | 40F |
InChI | InChI=1S/C8H11NO4/c9-8(7(12)13)2-1-3-4(5(3)8)6(10)11/h3-5H,1-2,9H2,(H,10,11)(H,12,13)/t3-,4-,5-,8-/m0/s1 |
InChIKey | VTAARTQTOOYTES-RGDLXGNYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C1C2CCC(C(=O)O)(N)C12 | OpenEye OEToolkits 1.9.2 | C1C[C@]([C@H]2[C@@H]1[C@@H]2C(=O)O)(C(=O)O)N | OpenEye OEToolkits 1.9.2 | C1CC(C2C1C2C(=O)O)(C(=O)O)N | CACTVS 3.385 | N[C]1(CC[CH]2[CH]([CH]12)C(O)=O)C(O)=O | CACTVS 3.385 | N[C@]1(CC[C@H]2[C@@H]([C@@H]12)C(O)=O)C(O)=O |
|
Formula | C8 H11 N O4 |
Name | (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
ChEMBL | CHEMBL8759 |
DrugBank | |
ZINC | ZINC000003824390
|
PDB chain | 4xar Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 4xar Synthesis and Pharmacological Characterization of C4-Disubstituted Analogs of 1S,2S,5R,6S-2-Aminobicyclo[3.1.0]hexane-2,6-dicarboxylate: Identification of a Potent, Selective Metabotropic Glutamate Receptor Agonist and Determination of Agonist-Bound Human mGlu2 and mGlu3 Amino Terminal Domain Structures. |
Resolution | 2.26 Å |
Binding residue (original residue number in PDB) | R64 R68 S149 Y150 S151 A172 S173 T174 Y222 D301 G302 K389 |
Binding residue (residue number reindexed from 1) | R35 R39 S98 Y99 S100 A121 S122 T123 Y171 D250 G251 K331 |
Annotation score | 1 |
Binding affinity | MOAD: Ki=107nM PDBbind-CN: -logKd/Ki=6.97,Ki=107nM BindingDB: EC50=38nM,Ki=93nM |
|
|
Enzyme Commision number |
? |
|
|
|