Structure of PDB 4wvo Chain A Binding Site BS01 |
|
|
Ligand ID | 3UZ |
InChI | InChI=1S/C23H22ClNO4/c1-4-14-28-20-11-6-17(16-21(20)27-3)12-13-25-23(26)22(29-15-5-2)18-7-9-19(24)10-8-18/h1-2,6-11,16,22H,12-15H2,3H3,(H,25,26)/t22-/m0/s1 |
InChIKey | KWLVWJPJKJMCSH-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COc1cc(ccc1OCC#C)CCNC(=O)[C@H](c2ccc(cc2)Cl)OCC#C | CACTVS 3.385 | COc1cc(CCNC(=O)[CH](OCC#C)c2ccc(Cl)cc2)ccc1OCC#C | CACTVS 3.385 | COc1cc(CCNC(=O)[C@@H](OCC#C)c2ccc(Cl)cc2)ccc1OCC#C | OpenEye OEToolkits 1.9.2 | COc1cc(ccc1OCC#C)CCNC(=O)C(c2ccc(cc2)Cl)OCC#C | ACDLabs 12.01 | Clc1ccc(cc1)C(OCC#C)C(=O)NCCc2ccc(OCC#C)c(OC)c2 |
|
Formula | C23 H22 Cl N O4 |
Name | (2S)-2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)ethanamide; Mandipropamid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000029126748
|
PDB chain | 4wvo Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|