Structure of PDB 4wrs Chain A Binding Site BS01 |
|
|
Ligand ID | 3U1 |
InChI | InChI=1S/C24H21F2N5O/c25-16-2-1-3-17(26)22(16)14-4-5-18-15(10-14)23(31-30-18)19-11-28-13-21(29-19)32-20-12-27-9-8-24(20)6-7-24/h1-5,10-11,13,20,27H,6-9,12H2,(H,30,31)/t20-/m0/s1 |
InChIKey | FCGLYPSBPNFQRF-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(c(c(c1)F)c2ccc3c(c2)c(n[nH]3)c4cncc(n4)O[C@H]5CNCCC56CC6)F | ACDLabs 12.01 | Fc6cccc(F)c6c1cc2c(cc1)nnc2c5nc(OC4C3(CC3)CCNC4)cnc5 | CACTVS 3.385 | Fc1cccc(F)c1c2ccc3[nH]nc(c4cncc(O[CH]5CNCCC56CC6)n4)c3c2 | CACTVS 3.385 | Fc1cccc(F)c1c2ccc3[nH]nc(c4cncc(O[C@H]5CNCCC56CC6)n4)c3c2 | OpenEye OEToolkits 1.9.2 | c1cc(c(c(c1)F)c2ccc3c(c2)c(n[nH]3)c4cncc(n4)OC5CNCCC56CC6)F |
|
Formula | C24 H21 F2 N5 O |
Name | 3-{6-[(4R)-6-azaspiro[2.5]oct-4-yloxy]pyrazin-2-yl}-5-(2,6-difluorophenyl)-1H-indazole |
ChEMBL | CHEMBL3393706 |
DrugBank | |
ZINC | ZINC000150136037
|
PDB chain | 4wrs Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|