Structure of PDB 4w8e Chain A Binding Site BS01 |
|
|
Ligand ID | 3JB |
InChI | InChI=1S/C20H17N7O2/c1-12-25-18(26-29-12)16-10-27(5-6-28-16)20-17-15(9-22-19(17)23-11-24-20)14-4-2-3-13(7-14)8-21/h2-4,7,9,11,16H,5-6,10H2,1H3,(H,22,23,24)/t16-/m1/s1 |
InChIKey | SAOVTENLRUIQAM-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1onc(n1)[CH]2CN(CCO2)c3ncnc4[nH]cc(c5cccc(c5)C#N)c34 | OpenEye OEToolkits 1.9.2 | Cc1nc(no1)C2CN(CCO2)c3c4c(c[nH]c4ncn3)c5cccc(c5)C#N | OpenEye OEToolkits 1.9.2 | Cc1nc(no1)[C@H]2CN(CCO2)c3c4c(c[nH]c4ncn3)c5cccc(c5)C#N | CACTVS 3.385 | Cc1onc(n1)[C@H]2CN(CCO2)c3ncnc4[nH]cc(c5cccc(c5)C#N)c34 | ACDLabs 12.01 | N#Cc1cccc(c1)c5c2c(ncnc2N4CCOC(c3nc(on3)C)C4)nc5 |
|
Formula | C20 H17 N7 O2 |
Name | 3-{4-[(2R)-2-(5-methyl-1,2,4-oxadiazol-3-yl)morpholin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl}benzonitrile |
ChEMBL | CHEMBL3393450 |
DrugBank | |
ZINC | ZINC000224867208
|
PDB chain | 4w8e Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|