Structure of PDB 4ufz Chain A Binding Site BS01 |
|
|
Ligand ID | IA7 |
InChI | InChI=1S/C15H15N7S/c1-15(2,3)14-20-10(13-19-4-5-23-13)8-9(17)7(6-16)11(18)21-12(8)22-14/h4-5H,1-3H3,(H4,17,18,20,21,22) |
InChIKey | VDKRFQKJPXSMOG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)(C)c1nc(c2c(c(c(nc2n1)N)C#N)N)c3nccs3 | CACTVS 3.385 | CC(C)(C)c1nc2nc(N)c(C#N)c(N)c2c(n1)c3sccn3 |
|
Formula | C15 H15 N7 S |
Name | 5,7-bis(azanyl)-2-tert-butyl-4-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carbonitrile |
ChEMBL | CHEMBL3632777 |
DrugBank | |
ZINC | ZINC000263621116
|
PDB chain | 4ufz Chain A Residue 1318
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|