Structure of PDB 4ual Chain A Binding Site BS01 |
|
|
Ligand ID | 3FV |
InChI | InChI=1S/C17H18ClN7O/c18-12-10-25(11-4-7-19-8-5-11)24-15(12)17(26)22-14-9-21-23-16(14)13-3-1-2-6-20-13/h1-3,6,9-11,19H,4-5,7-8H2,(H,21,23)(H,22,26) |
InChIKey | BPVZKUXLOLRECL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1cn(nc1C(=O)Nc2c[nH]nc2c3ccccn3)C4CCNCC4 | ACDLabs 12.01 | Clc1cn(nc1C(=O)Nc3cnnc3c2ncccc2)C4CCNCC4 | OpenEye OEToolkits 1.9.2 | c1ccnc(c1)c2c(c[nH]n2)NC(=O)c3c(cn(n3)C4CCNCC4)Cl |
|
Formula | C17 H18 Cl N7 O |
Name | 4-chloro-1-(piperidin-4-yl)-N-[3-(pyridin-2-yl)-1H-pyrazol-4-yl]-1H-pyrazole-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000223872936
|
PDB chain | 4ual Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|