Structure of PDB 4u5u Chain A Binding Site BS01 |
|
|
Ligand ID | 3D2 |
InChI | InChI=1S/C18H24N4O/c19-9-2-1-8-17(18(20)23)22-12-14-5-3-6-15(11-14)16-7-4-10-21-13-16/h3-7,10-11,13,17,22H,1-2,8-9,12,19H2,(H2,20,23)/t17-/m0/s1 |
InChIKey | HSVQHUWOLRPWEF-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)c2cccnc2)CNC(CCCCN)C(=O)N | ACDLabs 12.01 | O=C(N)C(NCc2cc(c1cccnc1)ccc2)CCCCN | OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)c2cccnc2)CN[C@@H](CCCCN)C(=O)N | CACTVS 3.385 | NCCCC[CH](NCc1cccc(c1)c2cccnc2)C(N)=O | CACTVS 3.385 | NCCCC[C@H](NCc1cccc(c1)c2cccnc2)C(N)=O |
|
Formula | C18 H24 N4 O |
Name | N~2~-[3-(pyridin-3-yl)benzyl]-L-lysinamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230471048
|
PDB chain | 4u5u Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|