Structure of PDB 4u4s Chain A Binding Site BS01 |
|
|
Ligand ID | 3C1 |
InChI | InChI=1S/C8H11N3O2S/c1-2-11-6-10-14(12,13)8-5-9-4-3-7(8)11/h3-5,10H,2,6H2,1H3 |
InChIKey | QAUSQKIKGJNUAS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCN1CNS(=O)(=O)c2c1ccnc2 | CACTVS 3.385 | CCN1CN[S](=O)(=O)c2cnccc12 | ACDLabs 12.01 | O=S2(=O)c1cnccc1N(CN2)CC |
|
Formula | C8 H11 N3 O2 S |
Name | 4-ethyl-3,4-dihydro-2H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide |
ChEMBL | CHEMBL99732 |
DrugBank | |
ZINC | ZINC000013555623
|
PDB chain | 4u4s Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|