Structure of PDB 4u42 Chain A Binding Site BS01 |
|
|
Ligand ID | 3C8 |
InChI | InChI=1S/C16H19N7/c1-10-7-20-22-14(10)11-3-2-6-23(8-11)13-5-4-12-15(21-13)16(17)19-9-18-12/h4-5,7,9,11H,2-3,6,8H2,1H3,(H,20,22)(H2,17,18,19)/t11-/m0/s1 |
InChIKey | NUOOXGXOVSCCHC-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1c[nH]nc1[C@H]2CCCN(C2)c3ccc4c(n3)c(ncn4)N | CACTVS 3.385 | Cc1c[nH]nc1[C@H]2CCCN(C2)c3ccc4ncnc(N)c4n3 | OpenEye OEToolkits 1.9.2 | Cc1c[nH]nc1C2CCCN(C2)c3ccc4c(n3)c(ncn4)N | ACDLabs 12.01 | n1c(c(cn1)C)C4CN(c3nc2c(ncnc2N)cc3)CCC4 | CACTVS 3.385 | Cc1c[nH]nc1[CH]2CCCN(C2)c3ccc4ncnc(N)c4n3 |
|
Formula | C16 H19 N7 |
Name | 6-[(3S)-3-(4-methyl-1H-pyrazol-3-yl)piperidin-1-yl]pyrido[3,2-d]pyrimidin-4-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000217351407
|
PDB chain | 4u42 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|