Structure of PDB 4u0v Chain A Binding Site BS01 |
|
|
Ligand ID | GLP |
InChI | InChI=1S/C6H14NO8P/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4-,5-,6+/m1/s1 |
InChIKey | XHMJOUIAFHJHBW-UKFBFLRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)N)O)O)OP(=O)(O)O | CACTVS 3.341 | N[CH]1[CH](O)O[CH](CO[P](O)(O)=O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)O)N)O)O)OP(=O)(O)O | CACTVS 3.341 | N[C@H]1[C@@H](O)O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H]1O | ACDLabs 10.04 | O=P(O)(O)OCC1OC(O)C(N)C(O)C1O |
|
Formula | C6 H14 N O8 P |
Name | 2-amino-2-deoxy-6-O-phosphono-alpha-D-glucopyranose; GLUCOSAMINE 6-PHOSPHATE; 6-O-phosphono-alpha-D-glucosamine; 2-amino-2-deoxy-6-O-phosphono-alpha-D-glucose; 2-amino-2-deoxy-6-O-phosphono-D-glucose; 2-amino-2-deoxy-6-O-phosphono-glucose |
ChEMBL | |
DrugBank | DB02657 |
ZINC | ZINC000004097103
|
PDB chain | 4u0v Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|