Structure of PDB 4tz8 Chain A Binding Site BS01 |
|
|
Ligand ID | 39U |
InChI | InChI=1S/C9H13N3OS/c1-9(2)3-5-6(7(13)11-4-9)14-8(10)12-5/h3-4H2,1-2H3,(H2,10,12)(H,11,13) |
InChIKey | KRPZAWRISMXVDQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NCC(Cc2nc(sc12)N)(C)C | OpenEye OEToolkits 1.9.2 | CC1(Cc2c(sc(n2)N)C(=O)NC1)C | CACTVS 3.385 | CC1(C)CNC(=O)c2sc(N)nc2C1 |
|
Formula | C9 H13 N3 O S |
Name | 2-amino-7,7-dimethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-c]azepin-4-one |
ChEMBL | CHEMBL3356579 |
DrugBank | |
ZINC | ZINC000000261915
|
PDB chain | 4tz8 Chain A Residue 1204
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|