Structure of PDB 4two Chain A Binding Site BS01 |
|
|
Ligand ID | 37W |
InChI | InChI=1S/C19H22N2O4S/c1-10-7-8-13(9-11(10)2)16-12(3)26-19(17(16)18(20)25)21-14(22)5-4-6-15(23)24/h7-9H,4-6H2,1-3H3,(H2,20,25)(H,21,22)(H,23,24) |
InChIKey | ZOPDRGUNCASWKP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1ccc(cc1C)c2c(sc(c2C(=O)N)NC(=O)CCCC(=O)O)C | ACDLabs 12.01 | O=C(Nc1sc(c(c1C(=O)N)c2ccc(c(c2)C)C)C)CCCC(=O)O | CACTVS 3.385 | Cc1sc(NC(=O)CCCC(O)=O)c(C(N)=O)c1c2ccc(C)c(C)c2 |
|
Formula | C19 H22 N2 O4 S |
Name | 5-{[3-carbamoyl-4-(3,4-dimethylphenyl)-5-methylthiophen-2-yl]amino}-5-oxopentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000017076622
|
PDB chain | 4two Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|