Structure of PDB 4tw9 Chain A Binding Site BS01 |
|
|
Ligand ID | 386 |
InChI | InChI=1S/C20H10F5N5O5S/c21-19(22,23)33-12-4-2-1-3-8(12)15(31)30-18-28-11(7-36-18)16(32)29-17-26-9-5-13-14(6-10(9)27-17)35-20(24,25)34-13/h1-7H,(H,28,30,31)(H2,26,27,29,32) |
InChIKey | DVVVOLSRHWJCHV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc4nc(C(=O)Nc3nc2cc1OC(F)(F)Oc1cc2n3)cs4)c5ccccc5OC(F)(F)F | CACTVS 3.385 | FC(F)(F)Oc1ccccc1C(=O)Nc2scc(n2)C(=O)Nc3[nH]c4cc5OC(F)(F)Oc5cc4n3 | OpenEye OEToolkits 1.9.2 | c1ccc(c(c1)C(=O)Nc2nc(cs2)C(=O)Nc3[nH]c4cc5c(cc4n3)OC(O5)(F)F)OC(F)(F)F |
|
Formula | C20 H10 F5 N5 O5 S |
Name | N-(2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)-2-{[2-(trifluoromethoxy)benzoyl]amino}-1,3-thiazole-4-carboxamide |
ChEMBL | CHEMBL3337845 |
DrugBank | |
ZINC | ZINC000098208406
|
PDB chain | 4tw9 Chain A Residue 1010
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D128 K130 |
Catalytic site (residue number reindexed from 1) |
D127 K129 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. 2.7.11.26: [tau protein] kinase. |
|
|
|