Structure of PDB 4rmz Chain A Binding Site BS01 |
|
|
Ligand ID | T20 |
InChI | InChI=1S/C26H25N5O3/c32-25(20-8-7-11-22(17-20)31(33)34)28-26-27-23-16-19(18-29-14-5-2-6-15-29)12-13-24(23)30(26)21-9-3-1-4-10-21/h1,3-4,7-13,16-17H,2,5-6,14-15,18H2,(H,27,28,32) |
InChIKey | IEOZVBDPTHRYGK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)n2c3ccc(cc3nc2NC(=O)c4cccc(c4)N(=O)=O)CN5CCCCC5 | CACTVS 3.385 | O=C(Nc1nc2cc(CN3CCCCC3)ccc2n1c4ccccc4)c5cccc(c5)[N](=O)=O | ACDLabs 12.01 | O=N(=O)c1cccc(c1)C(=O)Nc3nc4cc(ccc4n3c2ccccc2)CN5CCCCC5 |
|
Formula | C26 H25 N5 O3 |
Name | 3-nitro-N-[1-phenyl-5-(piperidin-1-ylmethyl)-1H-benzimidazol-2-yl]benzamide |
ChEMBL | CHEMBL3735719 |
DrugBank | |
ZINC | ZINC000038400974
|
PDB chain | 4rmz Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|