Structure of PDB 4rj7 Chain A Binding Site BS01 |
|
|
Ligand ID | 3R1 |
InChI | InChI=1S/C20H20Cl2N6O2/c1-11-8-17(28-20(24-11)25-12(2)10-29)27-16-9-13(6-7-23-16)26-19(30)18-14(21)4-3-5-15(18)22/h3-9,12,29H,10H2,1-2H3,(H3,23,24,25,26,27,28,30)/t12-/m0/s1 |
InChIKey | SMUCRZPXLSRBNU-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1cccc(Cl)c1C(=O)Nc2cc(ncc2)Nc3nc(nc(c3)C)NC(CO)C | CACTVS 3.385 | C[CH](CO)Nc1nc(C)cc(Nc2cc(NC(=O)c3c(Cl)cccc3Cl)ccn2)n1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(n1)NC(C)CO)Nc2cc(ccn2)NC(=O)c3c(cccc3Cl)Cl | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(n1)N[C@@H](C)CO)Nc2cc(ccn2)NC(=O)c3c(cccc3Cl)Cl | CACTVS 3.385 | C[C@@H](CO)Nc1nc(C)cc(Nc2cc(NC(=O)c3c(Cl)cccc3Cl)ccn2)n1 |
|
Formula | C20 H20 Cl2 N6 O2 |
Name | 2,6-dichloro-N-{2-[(2-{[(2S)-1-hydroxypropan-2-yl]amino}-6-methylpyrimidin-4-yl)amino]pyridin-4-yl}benzamide |
ChEMBL | CHEMBL3354183 |
DrugBank | |
ZINC | ZINC000204796107
|
PDB chain | 4rj7 Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|