Structure of PDB 4rio Chain A Binding Site BS01 |
|
|
Ligand ID | 3QX |
InChI | InChI=1S/C14H17FN4O/c1-14(15)6-2-5-11(14)18-12-9(13(16)20)8-17-19-7-3-4-10(12)19/h3-4,7-8,11,18H,2,5-6H2,1H3,(H2,16,20)/t11-,14+/m1/s1 |
InChIKey | UPBRYBJZTWHUQK-RISCZKNCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(CCCC1Nc2c3cccn3ncc2C(=O)N)F | CACTVS 3.385 | C[C]1(F)CCC[CH]1Nc2c3cccn3ncc2C(N)=O | OpenEye OEToolkits 1.7.6 | C[C@@]1(CCC[C@H]1Nc2c3cccn3ncc2C(=O)N)F | ACDLabs 12.01 | FC3(C)CCCC3Nc1c2cccn2ncc1C(=O)N | CACTVS 3.385 | C[C@]1(F)CCC[C@H]1Nc2c3cccn3ncc2C(N)=O |
|
Formula | C14 H17 F N4 O |
Name | 4-{[(1R,2S)-2-fluoro-2-methylcyclopentyl]amino}pyrrolo[1,2-b]pyridazine-3-carboxamide |
ChEMBL | CHEMBL3359927 |
DrugBank | |
ZINC | ZINC000203810743
|
PDB chain | 4rio Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|