Structure of PDB 4ren Chain A Binding Site BS01 |
|
|
Ligand ID | P5M |
InChI | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1 |
InChIKey | AFOLOMGWVXKIQL-UHFFFAOYSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cc(cc(c1O)O)c2c(cc3c(cc(cc3[o+]2)O)O)O | CACTVS 3.385 | COc1cc(cc(O)c1O)c2[o+]c3cc(O)cc(O)c3cc2O | ACDLabs 12.01 | Oc1cc(cc(OC)c1O)c3[o+]c2cc(O)cc(O)c2cc3O |
|
Formula | C16 H13 O7 |
Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromenium; Petunidin |
ChEMBL | CHEMBL1275624 |
DrugBank | |
ZINC | ZINC000003954302
|
PDB chain | 4ren Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|