Structure of PDB 4rcf Chain A Binding Site BS01 |
|
|
Ligand ID | 3LO |
InChI | InChI=1S/C25H19F2N3O3/c26-20-12-16(14-5-8-31-9-6-14)11-19-22(20)33-21-4-3-15(17-2-1-7-29-23(17)27)10-18(21)25(19)13-32-24(28)30-25/h1-5,7,10-12H,6,8-9,13H2,(H2,28,30)/t25-/m0/s1 |
InChIKey | UBJVRJGPVXTXQB-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=N[C@@]2(CO1)c3cc(ccc3Oc4c(F)cc(cc24)C5=CCOCC5)c6cccnc6F | ACDLabs 12.01 | Fc1ncccc1c6cc5c(Oc3c(F)cc(C2=CCOCC2)cc3C54N=C(OC4)N)cc6 | OpenEye OEToolkits 1.7.6 | c1cc(c(nc1)F)c2ccc3c(c2)[C@@]4(COC(=N4)N)c5cc(cc(c5O3)F)C6=CCOCC6 | OpenEye OEToolkits 1.7.6 | c1cc(c(nc1)F)c2ccc3c(c2)C4(COC(=N4)N)c5cc(cc(c5O3)F)C6=CCOCC6 | CACTVS 3.385 | NC1=N[C]2(CO1)c3cc(ccc3Oc4c(F)cc(cc24)C5=CCOCC5)c6cccnc6F |
|
Formula | C25 H19 F2 N3 O3 |
Name | (4S)-2'-(3,6-dihydro-2H-pyran-4-yl)-4'-fluoro-7'-(2-fluoropyridin-3-yl)spiro[1,3-oxazole-4,9'-xanthen]-2-amine |
ChEMBL | CHEMBL3354718 |
DrugBank | |
ZINC | ZINC000117733754
|
PDB chain | 4rcf Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|