Structure of PDB 4rcd Chain A Binding Site BS01 |
|
|
Ligand ID | 3LL |
InChI | InChI=1S/C25H19FN4O3/c1-24(12-31-13-24)7-6-15-9-19-22(29-11-15)33-20-5-4-16(17-3-2-8-28-21(17)26)10-18(20)25(19)14-32-23(27)30-25/h2-5,8-11H,12-14H2,1H3,(H2,27,30)/t25-/m0/s1 |
InChIKey | GKKFBOARESVMBW-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1(COC1)C#Cc2cnc3Oc4ccc(cc4[C]5(COC(=N5)N)c3c2)c6cccnc6F | OpenEye OEToolkits 1.7.6 | CC1(COC1)C#Cc2cc3c(nc2)Oc4ccc(cc4C35COC(=N5)N)c6cccnc6F | OpenEye OEToolkits 1.7.6 | CC1(COC1)C#Cc2cc3c(nc2)Oc4ccc(cc4[C@@]35COC(=N5)N)c6cccnc6F | ACDLabs 12.01 | Fc1ncccc1c6cc5c(Oc3ncc(C#CC2(C)COC2)cc3C54N=C(OC4)N)cc6 | CACTVS 3.385 | CC1(COC1)C#Cc2cnc3Oc4ccc(cc4[C@@]5(COC(=N5)N)c3c2)c6cccnc6F |
|
Formula | C25 H19 F N4 O3 |
Name | (5S)-7-(2-fluoropyridin-3-yl)-3-[(3-methyloxetan-3-yl)ethynyl]spiro[chromeno[2,3-b]pyridine-5,4'-[1,3]oxazol]-2'-amine |
ChEMBL | CHEMBL3359763 |
DrugBank | |
ZINC | ZINC000117741467
|
PDB chain | 4rcd Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|