Structure of PDB 4ran Chain A Binding Site BS01 |
|
|
Ligand ID | 3L6 |
InChI | InChI=1S/C12H22N7O4P/c13-2-1-3-18(6-7-24(21,22)23)4-5-19-8-15-9-10(19)16-12(14)17-11(9)20/h8H,1-7,13H2,(H2,21,22,23)(H3,14,16,17,20) |
InChIKey | JXSWXCFQTAYPAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1nc2c(n1CCN(CCCN)CCP(=O)(O)O)N=C(NC2=O)N | CACTVS 3.385 | NCCCN(CCn1cnc2C(=O)NC(=Nc12)N)CC[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)CCN(CCCN)CCn1c2N=C(NC(=O)c2nc1)N |
|
Formula | C12 H22 N7 O4 P |
Name | (2-{[2-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)ethyl](3-aminopropyl)amino}ethyl)phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000221703225
|
PDB chain | 4ran Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|