Structure of PDB 4r75 Chain A Binding Site BS01 |
|
|
Ligand ID | S7P |
InChI | InChI=1S/C7H15O10P/c8-2-7(12)6(11)4(10)5(17-7)3(9)1-16-18(13,14)15/h3-6,8-12H,1-2H2,(H2,13,14,15)/t3-,4-,5-,6+,7-/m1/s1 |
InChIKey | RKCHIPUTSFLEHR-BNWJMWRWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C([C@H]([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)O)OP(=O)(O)O | CACTVS 3.385 | OC[C@@]1(O)O[C@H]([C@H](O)CO[P](O)(O)=O)[C@@H](O)[C@@H]1O | ACDLabs 12.01 | O=P(O)(O)OCC(O)C1OC(O)(CO)C(O)C1O | CACTVS 3.385 | OC[C]1(O)O[CH]([CH](O)CO[P](O)(O)=O)[CH](O)[CH]1O | OpenEye OEToolkits 1.7.6 | C(C(C1C(C(C(O1)(CO)O)O)O)O)OP(=O)(O)O |
|
Formula | C7 H15 O10 P |
Name | 1-C-(hydroxymethyl)-6-O-phosphono-beta-D-altrofuranose; 1-C-(hydroxymethyl)-6-O-phosphono-beta-D-altrose; 1-C-(hydroxymethyl)-6-O-phosphono-D-altrose; 1-C-(hydroxymethyl)-6-O-phosphono-altrose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620973
|
PDB chain | 4r75 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|