Structure of PDB 4qt1 Chain A Binding Site BS01 |
|
|
Ligand ID | 3C9 |
InChI | InChI=1S/C16H24N6O3S/c1-11(2)10-26(24,25)22-7-3-4-12(9-22)19-16(23)21-14-8-18-15-13(20-14)5-6-17-15/h5-6,8,11-12H,3-4,7,9-10H2,1-2H3,(H,17,18)(H2,19,20,21,23)/t12-/m0/s1 |
InChIKey | UTTDMGAEOAWZGU-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)CS(=O)(=O)N1CCC[C@@H](C1)NC(=O)Nc2cnc3c(n2)cc[nH]3 | CACTVS 3.385 | CC(C)C[S](=O)(=O)N1CCC[CH](C1)NC(=O)Nc2cnc3[nH]ccc3n2 | ACDLabs 12.01 | O=S(=O)(N3CCCC(NC(=O)Nc1nc2c(nc1)ncc2)C3)CC(C)C | CACTVS 3.385 | CC(C)C[S](=O)(=O)N1CCC[C@@H](C1)NC(=O)Nc2cnc3[nH]ccc3n2 | OpenEye OEToolkits 1.7.6 | CC(C)CS(=O)(=O)N1CCCC(C1)NC(=O)Nc2cnc3c(n2)cc[nH]3 |
|
Formula | C16 H24 N6 O3 S |
Name | 1-{(3S)-1-[(2-methylpropyl)sulfonyl]piperidin-3-yl}-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
ChEMBL | CHEMBL3335685 |
DrugBank | |
ZINC | ZINC000068208584
|
PDB chain | 4qt1 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|