Structure of PDB 4qrc Chain A Binding Site BS01 |
|
|
Ligand ID | 0LI |
InChI | InChI=1S/C29H27F3N6O/c1-20-5-6-22(16-21(20)8-10-25-18-33-27-4-3-11-34-38(25)27)28(39)35-24-9-7-23(26(17-24)29(30,31)32)19-37-14-12-36(2)13-15-37/h3-7,9,11,16-18H,12-15,19H2,1-2H3,(H,35,39) |
InChIKey | PHXJVRSECIGDHY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CCN(CC1)Cc2ccc(NC(=O)c3ccc(C)c(c3)C#Cc4cnc5cccnn45)cc2C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c1cc(ccc1CN2CCN(C)CC2)NC(=O)c5cc(C#Cc3cnc4cccnn34)c(cc5)C | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1C#Cc2cnc3n2nccc3)C(=O)Nc4ccc(c(c4)C(F)(F)F)CN5CCN(CC5)C |
|
Formula | C29 H27 F3 N6 O |
Name | 3-(imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-{4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl}benzam ide; Ponatinib |
ChEMBL | CHEMBL1171837 |
DrugBank | DB08901 |
ZINC | ZINC000036701290
|
PDB chain | 4qrc Chain A Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|