Structure of PDB 4qr5 Chain A Binding Site BS01 |
|
|
Ligand ID | BNM |
InChI | InChI=1S/C18H21N3O4S2/c22-17(11-5-6-11)19-14-7-12(16-10-26-18(23)20-16)8-15(9-14)27(24,25)21-13-3-1-2-4-13/h7-11,13,21H,1-6H2,(H,19,22)(H,20,23) |
InChIKey | OLJJIVPNEQZRJR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1NC(=CS1)c2cc(NC(=O)C3CC3)cc(c2)[S](=O)(=O)NC4CCCC4 | OpenEye OEToolkits 1.7.6 | c1c(cc(cc1NC(=O)C2CC2)S(=O)(=O)NC3CCCC3)C4=CSC(=O)N4 | ACDLabs 12.01 | O=C4SC=C(c2cc(cc(NC(=O)C1CC1)c2)S(=O)(=O)NC3CCCC3)N4 |
|
Formula | C18 H21 N3 O4 S2 |
Name | N-[3-(cyclopentylsulfamoyl)-5-(2-oxo-2,3-dihydro-1,3-thiazol-4-yl)phenyl]cyclopropanecarboxamide |
ChEMBL | CHEMBL3410003 |
DrugBank | |
ZINC | ZINC000263620844
|
PDB chain | 4qr5 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|