Structure of PDB 4qr3 Chain A Binding Site BS01 |
|
|
Ligand ID | BNJ |
InChI | InChI=1S/C14H16N2O3S2/c17-14-15-13(9-20-14)10-4-3-7-12(8-10)21(18,19)16-11-5-1-2-6-11/h3-4,7-9,11,16H,1-2,5-6H2,(H,15,17) |
InChIKey | YNSRHWKJAMIAPD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1NC(=CS1)c2cccc(c2)[S](=O)(=O)NC3CCCC3 | ACDLabs 12.01 | O=C3SC=C(c1cc(ccc1)S(=O)(=O)NC2CCCC2)N3 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)S(=O)(=O)NC2CCCC2)C3=CSC(=O)N3 |
|
Formula | C14 H16 N2 O3 S2 |
Name | N-cyclopentyl-3-(2-oxo-2,3-dihydro-1,3-thiazol-4-yl)benzenesulfonamide |
ChEMBL | CHEMBL3409982 |
DrugBank | |
ZINC | ZINC000263621288
|
PDB chain | 4qr3 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|