Structure of PDB 4qmw Chain A Binding Site BS01 |
|
|
Ligand ID | KS1 |
InChI | InChI=1S/C17H17N7/c18-15-13-14(11-7-10-5-6-19-16(10)20-8-11)23-24(12-3-1-2-4-12)17(13)22-9-21-15/h5-9,12H,1-4H2,(H,19,20)(H2,18,21,22) |
InChIKey | NVRXTLZYXZNATH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1c[nH]c2c1cc(cn2)c3c4c(ncnc4n(n3)C5CCCC5)N | CACTVS 3.341 | Nc1ncnc2n(nc(c3cnc4[nH]ccc4c3)c12)C5CCCC5 | ACDLabs 10.04 | n1c(c2c(nc1)n(nc2c3cc4ccnc4nc3)C5CCCC5)N |
|
Formula | C17 H17 N7 |
Name | 1-cyclopentyl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
ChEMBL | CHEMBL1081312 |
DrugBank | DB08052 |
ZINC | ZINC000020148984
|
PDB chain | 4qmw Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|