Structure of PDB 4ql8 Chain A Binding Site BS01 |
|
|
Ligand ID | JAD |
InChI | InChI=1S/C15H16ClN3O2/c1-8-10(4-3-9(7-17)12(8)16)13-15(21-2)14-11(20)5-6-19(14)18-13/h3-4,11,14-15,20H,5-6H2,1-2H3/t11-,14-,15+/m0/s1 |
InChIKey | RJZJEPYCJHLWQR-TUKIKUTGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(ccc(c1Cl)C#N)C2=NN3CCC(C3C2OC)O | OpenEye OEToolkits 1.7.6 | Cc1c(ccc(c1Cl)C#N)C2=NN3CC[C@@H]([C@H]3[C@@H]2OC)O | ACDLabs 12.01 | N#Cc3ccc(C2=NN1CCC(O)C1C2OC)c(c3Cl)C | CACTVS 3.385 | CO[CH]1[CH]2[CH](O)CCN2N=C1c3ccc(C#N)c(Cl)c3C | CACTVS 3.385 | CO[C@H]1[C@@H]2[C@@H](O)CCN2N=C1c3ccc(C#N)c(Cl)c3C |
|
Formula | C15 H16 Cl N3 O2 |
Name | 2-chloro-4-[(3S,3aS,4S)-4-hydroxy-3-methoxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b]pyrazol-2-yl]-3-methylbenzonitrile |
ChEMBL | CHEMBL3326454 |
DrugBank | |
ZINC | ZINC000146592897
|
PDB chain | 4ql8 Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|