Structure of PDB 4qkx Chain A Binding Site BS01 |
|
|
Ligand ID | 35V |
InChI | InChI=1S/C19H25NO5S/c1-24-19-10-13(2-5-18(19)25-8-9-26)6-7-20-12-17(23)14-3-4-15(21)16(22)11-14/h2-5,10-11,17,20-23,26H,6-9,12H2,1H3/t17-/m0/s1 |
InChIKey | ABMSPPLJHILUDP-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cc(ccc1OCCS)CCNC[C@@H](c2ccc(c(c2)O)O)O | ACDLabs 12.01 | O(c1ccc(cc1OC)CCNCC(O)c2ccc(O)c(O)c2)CCS | OpenEye OEToolkits 1.7.6 | COc1cc(ccc1OCCS)CCNCC(c2ccc(c(c2)O)O)O | CACTVS 3.385 | COc1cc(CCNC[CH](O)c2ccc(O)c(O)c2)ccc1OCCS | CACTVS 3.385 | COc1cc(CCNC[C@H](O)c2ccc(O)c(O)c2)ccc1OCCS |
|
Formula | C19 H25 N O5 S |
Name | 4-[(1R)-1-hydroxy-2-({2-[3-methoxy-4-(2-sulfanylethoxy)phenyl]ethyl}amino)ethyl]benzene-1,2-diol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208394
|
PDB chain | 4qkx Chain A Residue 1403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E876 D885 |
Catalytic site (residue number reindexed from 1) |
E19 D28 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|