Structure of PDB 4qf9 Chain A Binding Site BS01 |
|
|
Ligand ID | 35K |
InChI | InChI=1S/C12H13N3O4/c13-7(12(18)19)3-1-6-2-4-8-9(5-6)15-11(17)10(16)14-8/h2,4-5,7H,1,3,13H2,(H,14,16)(H,15,17)(H,18,19)/t7-/m0/s1 |
InChIKey | HOBORVHHDCBXLX-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[CH](CCc1ccc2NC(=O)C(=O)Nc2c1)C(O)=O | ACDLabs 12.01 | O=C(O)C(N)CCc1ccc2c(c1)NC(=O)C(=O)N2 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1CCC(C(=O)O)N)NC(=O)C(=O)N2 | CACTVS 3.385 | N[C@@H](CCc1ccc2NC(=O)C(=O)Nc2c1)C(O)=O | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1CC[C@@H](C(=O)O)N)NC(=O)C(=O)N2 |
|
Formula | C12 H13 N3 O4 |
Name | (2S)-2-amino-4-(2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)butanoic acid |
ChEMBL | CHEMBL5177751 |
DrugBank | |
ZINC | ZINC000263620519
|
PDB chain | 4qf9 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|