Structure of PDB 4qeb Chain A Binding Site BS01 |
|
|
Ligand ID | 31G |
InChI | InChI=1S/C15H14N4O4S/c16-14-13-11(18-15(17)19-14)5-2-6-12(13)23-8-9-3-1-4-10(7-9)24(20,21)22/h1-7H,8H2,(H,20,21,22)(H4,16,17,18,19) |
InChIKey | FEIMDUGCGJFTCE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1nc(N)c2c(OCc3cccc(c3)[S](O)(=O)=O)cccc2n1 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)S(=O)(=O)O)COc2cccc3c2c(nc(n3)N)N | ACDLabs 12.01 | O=S(=O)(O)c1cccc(c1)COc3c2c(nc(nc2N)N)ccc3 |
|
Formula | C15 H14 N4 O4 S |
Name | 3-{[(2,4-diaminoquinazolin-5-yl)oxy]methyl}benzenesulfonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230498366
|
PDB chain | 4qeb Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.1.59: 5'-(N(7)-methyl 5'-triphosphoguanosine)-[mRNA] diphosphatase. |
|
|
|