Structure of PDB 4qb3 Chain A Binding Site BS01 |
|
|
Ligand ID | 30M |
InChI | InChI=1S/C17H21N3O2/c1-12(21)18-9-4-5-11-20-14-7-3-2-6-13(14)16-15(20)8-10-19-17(16)22/h2-3,6-7H,4-5,8-11H2,1H3,(H,18,21)(H,19,22) |
InChIKey | RYVLOOXFFIFQEN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=O)NCCCCn1c2ccccc2c3c1CCNC3=O | CACTVS 3.385 | CC(=O)NCCCCn1c2CCNC(=O)c2c3ccccc13 | ACDLabs 12.01 | O=C3c2c1c(cccc1)n(c2CCN3)CCCCNC(=O)C |
|
Formula | C17 H21 N3 O2 |
Name | N-[4-(1-oxo-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)butyl]acetamide |
ChEMBL | CHEMBL3770724 |
DrugBank | |
ZINC | ZINC000231374390
|
PDB chain | 4qb3 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|