Structure of PDB 4q9z Chain A Binding Site BS01 |
|
|
Ligand ID | PZW |
InChI | InChI=1S/C15H19N5O2/c1-8-3-13-12(4-11(8)17-10-5-16-6-10)20-9(2)15(21)19-18-14(20)7-22-13/h3-4,9-10,16-17H,5-7H2,1-2H3,(H,19,21)/t9-/m1/s1 |
InChIKey | YWULJUISHNTGOC-SECBINFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH]1N2C(=NNC1=O)COc3cc(C)c(NC4CNC4)cc23 | OpenEye OEToolkits 1.7.6 | Cc1cc2c(cc1NC3CNC3)N4C(C(=O)NN=C4CO2)C | OpenEye OEToolkits 1.7.6 | Cc1cc2c(cc1NC3CNC3)N4[C@@H](C(=O)NN=C4CO2)C | CACTVS 3.385 | C[C@H]1N2C(=NNC1=O)COc3cc(C)c(NC4CNC4)cc23 | ACDLabs 12.01 | O=C4NN=C1N(c3c(OC1)cc(c(NC2CNC2)c3)C)C4C |
|
Formula | C15 H19 N5 O2 |
Name | (1R)-9-(azetidin-3-ylamino)-1,8-dimethyl-3,5-dihydro[1,2,4]triazino[3,4-c][1,4]benzoxazin-2(1H)-one |
ChEMBL | CHEMBL3356470 |
DrugBank | |
ZINC | ZINC000098209327
|
PDB chain | 4q9z Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|