Structure of PDB 4q6r Chain A Binding Site BS01 |
|
|
Ligand ID | 30J |
InChI | InChI=1S/C26H23ClN6/c1-18-17-32(11-12-33(18)25-10-7-20(15-28)16-29-25)26-23-14-21(27)8-9-22(23)24(30-31-26)13-19-5-3-2-4-6-19/h2-10,14,16,18H,11-13,17H2,1H3/t18-/m1/s1 |
InChIKey | XUZUIICAPXZZDU-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH]1CN(CCN1c2ccc(cn2)C#N)c3nnc(Cc4ccccc4)c5ccc(Cl)cc35 | CACTVS 3.385 | C[C@@H]1CN(CCN1c2ccc(cn2)C#N)c3nnc(Cc4ccccc4)c5ccc(Cl)cc35 | OpenEye OEToolkits 1.7.6 | C[C@@H]1CN(CCN1c2ccc(cn2)C#N)c3c4cc(ccc4c(nn3)Cc5ccccc5)Cl | ACDLabs 12.01 | Clc1cc4c(cc1)c(nnc4N3CC(N(c2ncc(C#N)cc2)CC3)C)Cc5ccccc5 | OpenEye OEToolkits 1.7.6 | CC1CN(CCN1c2ccc(cn2)C#N)c3c4cc(ccc4c(nn3)Cc5ccccc5)Cl |
|
Formula | C26 H23 Cl N6 |
Name | 6-[(2R)-4-(4-benzyl-7-chlorophthalazin-1-yl)-2-methylpiperazin-1-yl]pyridine-3-carbonitrile |
ChEMBL | CHEMBL3290331 |
DrugBank | |
ZINC | ZINC000098208367
|
PDB chain | 4q6r Chain A Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.1.2.27: sphinganine-1-phosphate aldolase. |
|
|
|