Structure of PDB 4pzx Chain A Binding Site BS01 |
|
|
Ligand ID | 2X5 |
InChI | InChI=1S/C19H18ClN3O3/c20-13-5-12(7-22-8-13)11-1-2-16-15(6-11)19(10-25-18(21)23-19)14-3-4-24-9-17(14)26-16/h1-2,5-8,14,17H,3-4,9-10H2,(H2,21,23)/t14-,17-,19+/m0/s1 |
InChIKey | BGRWOLNAPSRJIS-UCLAIMLFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1cc(cnc1)c5cc3c(OC4COCCC4C32N=C(OC2)N)cc5 | CACTVS 3.385 | NC1=N[C]2(CO1)[CH]3CCOC[CH]3Oc4ccc(cc24)c5cncc(Cl)c5 | CACTVS 3.385 | NC1=N[C@]2(CO1)[C@H]3CCOC[C@@H]3Oc4ccc(cc24)c5cncc(Cl)c5 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1c3cc(cnc3)Cl)C4(COC(=N4)N)C5CCOCC5O2 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1c3cc(cnc3)Cl)[C@@]4(COC(=N4)N)[C@H]5CCOC[C@@H]5O2 |
|
Formula | C19 H18 Cl N3 O3 |
Name | (4R,4a'R,10a'R)-7'-(5-chloropyridin-3-yl)-3',4',4a',10a'-tetrahydro-1'H-spiro[1,3-oxazole-4,5'-pyrano[3,4-b]chromen]-2-amine |
ChEMBL | CHEMBL3265335 |
DrugBank | |
ZINC | ZINC000098208343
|
PDB chain | 4pzx Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|