Structure of PDB 4p10 Chain A Binding Site BS01 |
|
|
Ligand ID | 2B8 |
InChI | InChI=1S/C14H23N3O2/c1-2-8-17-10-16-11-9-14(13(18)19,5-3-7-15)6-4-12(11)17/h10H,2-9,15H2,1H3,(H,18,19)/t14-/m1/s1 |
InChIKey | DPDWQELEXVLQSO-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCn1cnc2C[C@@](CCCN)(CCc12)C(O)=O | CACTVS 3.385 | CCCn1cnc2C[C](CCCN)(CCc12)C(O)=O | OpenEye OEToolkits 1.9.2 | CCCn1cnc2c1CCC(C2)(CCCN)C(=O)O | OpenEye OEToolkits 1.9.2 | CCCn1cnc2c1CC[C@@](C2)(CCCN)C(=O)O | ACDLabs 12.01 | O=C(O)C2(CCc1c(ncn1CCC)C2)CCCN |
|
Formula | C14 H23 N3 O2 |
Name | (5R)-5-(3-aminopropyl)-1-propyl-4,5,6,7-tetrahydro-1H-benzimidazole-5-carboxylic acid |
ChEMBL | CHEMBL3235132 |
DrugBank | |
ZINC | ZINC000098208124
|
PDB chain | 4p10 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|