Structure of PDB 4p0x Chain A Binding Site BS01 |
|
|
Ligand ID | 1WO |
InChI | InChI=1S/C20H26O3/c1-11(2)13-9-12-10-14(21)18-19(3,4)7-6-8-20(18,5)15(12)17(23)16(13)22/h9-11,18,23H,6-8H2,1-5H3/t18-,20+/m0/s1 |
InChIKey | FNNZMRSRVYUVQT-AZUAARDMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C1=CC2=CC(=O)[CH]3C(C)(C)CCC[C]3(C)C2=C(O)C1=O | OpenEye OEToolkits 1.9.2 | CC(C)C1=CC2=CC(=O)C3C(CCCC3(C2=C(C1=O)O)C)(C)C | ACDLabs 12.01 | O=C2C(=CC1=CC(=O)C3C(C1=C2O)(CCCC3(C)C)C)C(C)C | OpenEye OEToolkits 1.9.2 | CC(C)C1=CC2=CC(=O)[C@@H]3[C@@](C2=C(C1=O)O)(CCCC3(C)C)C | CACTVS 3.385 | CC(C)C1=CC2=CC(=O)[C@H]3C(C)(C)CCC[C@]3(C)C2=C(O)C1=O |
|
Formula | C20 H26 O3 |
Name | (5beta)-11-hydroxyabieta-7,9(11),13-triene-6,12-dione; taxodione |
ChEMBL | CHEMBL235195 |
DrugBank | |
ZINC | ZINC000030726792
|
PDB chain | 4p0x Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|