Structure of PDB 4ovz Chain A Binding Site BS01 |
|
|
Ligand ID | P85 |
InChI | InChI=1S/C25H27FN2O/c1-18(23-8-4-6-20-5-2-3-7-24(20)23)28-15-13-21(14-16-28)25(29)27-17-19-9-11-22(26)12-10-19/h2-12,18,21H,13-17H2,1H3,(H,27,29)/t18-/m1/s1 |
InChIKey | VTAUBQMDNJOEAK-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4ccc(cc4)F | CACTVS 3.385 | C[C@@H](N1CC[C@@H](CC1)C(=O)NCc2ccc(F)cc2)c3cccc4ccccc34 | CACTVS 3.385 | C[CH](N1CC[CH](CC1)C(=O)NCc2ccc(F)cc2)c3cccc4ccccc34 | OpenEye OEToolkits 1.9.2 | C[C@H](c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4ccc(cc4)F | ACDLabs 12.01 | Fc1ccc(cc1)CNC(=O)C4CCN(C(c3c2ccccc2ccc3)C)CC4 |
|
Formula | C25 H27 F N2 O |
Name | N-[(4-fluorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide |
ChEMBL | CHEMBL3233814 |
DrugBank | |
ZINC |
|
PDB chain | 4ovz Chain A Residue 902
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|