Structure of PDB 4oma Chain A Binding Site BS01 |
|
|
Ligand ID | LCS |
InChI | InChI=1S/C11H14N3O7P/c1-6-10(15)8(3-13-9-5-20-14-11(9)16)7(2-12-6)4-21-22(17,18)19/h2,15H,3-5H2,1H3,(H,14,16)(H2,17,18,19)/b13-9+ |
InChIKey | KFCQHWOGBVCKHR-UKTHLTGXSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2/C(=N/Cc1c(cnc(c1O)C)COP(=O)(O)O)CON2 | OpenEye OEToolkits 1.7.2 | Cc1c(c(c(cn1)COP(=O)(O)O)CN=C2CONC2=O)O | CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(CN=C2CONC2=O)c1O | OpenEye OEToolkits 1.7.2 | Cc1c(c(c(cn1)COP(=O)(O)O)C/N=C/2\CONC2=O)O |
|
Formula | C11 H14 N3 O7 P |
Name | [5-hydroxy-6-methyl-4-({[(4E)-3-oxo-1,2-oxazolidin-4-ylidene]amino}methyl)pyridin-3-yl]methyl dihydrogen phosphate |
ChEMBL | |
DrugBank | DB03787 |
ZINC | ZINC000103548283
|
PDB chain | 4oma Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|