Structure of PDB 4olg Chain A Binding Site BS01 |
|
|
Ligand ID | 2TV |
InChI | InChI=1S/C11H12N2O6S/c1-6(16)19-3-7-4-20-10(8(2-14)12-5-15)13-9(7)11(17)18/h2-3,5,8,10H,4H2,1H3,(H,12,15)(H,17,18)/b7-3+/t8-,10-/m1/s1 |
InChIKey | FUAVSDQKXSFRBB-WPGHDDCOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=O)OC=C1CSC(N=C1C(=O)O)C(C=O)NC=O | OpenEye OEToolkits 1.7.6 | CC(=O)O/C=C/1\CSC(N=C1C(=O)O)C(C=O)NC=O | CACTVS 3.370 | CC(=O)OC=C1CS[CH](N=C1C(O)=O)[CH](NC=O)C=O | CACTVS 3.370 | CC(=O)O\C=C1/CS[C@@H](N=C1C(O)=O)[C@H](NC=O)C=O | ACDLabs 12.01 | O=CC(NC=O)C1N=C(\C(=C\OC(=O)C)CS1)C(=O)O |
|
Formula | C11 H12 N2 O6 S |
Name | (2R,5Z)-5-[(acetyloxy)methylidene]-2-[(1R)-1-(formylamino)-2-oxoethyl]-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid; N-formyl 7-aminocephalosporanic acid, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208276
|
PDB chain | 4olg Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|