Structure of PDB 4ogb Chain A Binding Site BS01 |
|
|
Ligand ID | 2SR |
InChI | InChI=1S/C23H26O5/c1-14-10-17(16-4-5-20(25-2)22(12-16)26-3)23-18(11-14)19(24)13-21(28-23)15-6-8-27-9-7-15/h4-5,10-13,15,21,24H,6-9H2,1-3H3/t21-/m0/s1 |
InChIKey | RVKGQUJUMMUCKA-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1OC)c2cc(C)cc3C(=C[CH](Oc23)C4CCOCC4)O | OpenEye OEToolkits 1.7.6 | Cc1cc(c2c(c1)C(=C[C@H](O2)C3CCOCC3)O)c4ccc(c(c4)OC)OC | CACTVS 3.385 | COc1ccc(cc1OC)c2cc(C)cc3C(=C[C@H](Oc23)C4CCOCC4)O | ACDLabs 12.01 | O3c2c(c1ccc(OC)c(OC)c1)cc(cc2C(O)=CC3C4CCOCC4)C | OpenEye OEToolkits 1.7.6 | Cc1cc(c2c(c1)C(=CC(O2)C3CCOCC3)O)c4ccc(c(c4)OC)OC |
|
Formula | C23 H26 O5 |
Name | (2R)-8-(3,4-dimethoxyphenyl)-6-methyl-2-(tetrahydro-2H-pyran-4-yl)-2H-chromen-4-ol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000222801689
|
PDB chain | 4ogb Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|