Structure of PDB 4o55 Chain A Binding Site BS01 |
|
|
Ligand ID | LF9 |
InChI | InChI=1S/C26H26ClN3O3/c1-14-20(16-9-7-6-8-10-16)21(23(25(31)32)33-26(3,4)5)15(2)28-22(14)24-29-18-12-11-17(27)13-19(18)30-24/h6-13,23H,1-5H3,(H,29,30)(H,31,32)/t23-/m0/s1 |
InChIKey | CTTJHLOYHQRQKO-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1nc(c(C)c(c2ccccc2)c1[CH](OC(C)(C)C)C(O)=O)c3[nH]c4ccc(Cl)cc4n3 | ACDLabs 12.01 | O=C(O)C(OC(C)(C)C)c2c(c1ccccc1)c(c(nc2C)c4nc3cc(Cl)ccc3n4)C | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(nc1c2[nH]c3ccc(cc3n2)Cl)C)C(C(=O)O)OC(C)(C)C)c4ccccc4 | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(nc1c2[nH]c3ccc(cc3n2)Cl)C)[C@@H](C(=O)O)OC(C)(C)C)c4ccccc4 | CACTVS 3.385 | Cc1nc(c(C)c(c2ccccc2)c1[C@H](OC(C)(C)C)C(O)=O)c3[nH]c4ccc(Cl)cc4n3 |
|
Formula | C26 H26 Cl N3 O3 |
Name | (2S)-tert-butoxy[6-(5-chloro-1H-benzimidazol-2-yl)-2,5-dimethyl-4-phenylpyridin-3-yl]ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209108
|
PDB chain | 4o55 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|