Structure of PDB 4o0y Chain A Binding Site BS01 |
|
|
Ligand ID | 2OO |
InChI | InChI=1S/C17H19N7O/c1-4-19-15-22-12-6-5-11(7-8-17(2,3)25)9-13(12)24(15)16-21-10-20-14(18)23-16/h5-6,9-10,25H,4H2,1-3H3,(H,19,22)(H2,18,20,21,23) |
InChIKey | NDZPPXQOOUNQTQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCNc1nc2ccc(cc2n1c3ncnc(N)n3)C#CC(C)(C)O | OpenEye OEToolkits 1.7.6 | CCNc1nc2ccc(cc2n1c3ncnc(n3)N)C#CC(C)(C)O | ACDLabs 12.01 | n2c1ccc(C#CC(O)(C)C)cc1n(c2NCC)c3ncnc(n3)N |
|
Formula | C17 H19 N7 O |
Name | 4-[1-(4-amino-1,3,5-triazin-2-yl)-2-(ethylamino)-1H-benzimidazol-6-yl]-2-methylbut-3-yn-2-ol |
ChEMBL | CHEMBL3128055 |
DrugBank | |
ZINC | ZINC000098208221
|
PDB chain | 4o0y Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|