Structure of PDB 4o0x Chain A Binding Site BS01 |
|
|
Ligand ID | 2OQ |
InChI | InChI=1S/C19H20N6O/c1-13-23-15-6-5-14(7-10-19(26)8-3-2-4-9-19)11-16(15)25(13)18-22-12-21-17(20)24-18/h5-6,11-12,26H,2-4,8-9H2,1H3,(H2,20,21,22,24) |
InChIKey | RSIUBEYNBJJYTG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1nc2ccc(cc2n1c3ncnc(n3)N)C#CC4(CCCCC4)O | CACTVS 3.385 | Cc1nc2ccc(cc2n1c3ncnc(N)n3)C#CC4(O)CCCCC4 | ACDLabs 12.01 | n3c2ccc(C#CC1(O)CCCCC1)cc2n(c3C)c4ncnc(n4)N |
|
Formula | C19 H20 N6 O |
Name | 1-{[1-(4-amino-1,3,5-triazin-2-yl)-2-methyl-1H-benzimidazol-6-yl]ethynyl}cyclohexanol |
ChEMBL | CHEMBL3128050 |
DrugBank | |
ZINC | ZINC000098208222
|
PDB chain | 4o0x Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|