Structure of PDB 4o0r Chain A Binding Site BS01 |
|
|
Ligand ID | 7KC |
InChI | InChI=1S/C25H30N8OS/c1-15-26-18-11-12-35-20(18)23(27-15)29-22-17-13-33(25(2,3)21(17)30-31-22)24(34)28-19(14-32(4)5)16-9-7-6-8-10-16/h6-12,19H,13-14H2,1-5H3,(H,28,34)(H2,26,27,29,30,31)/t19-/m1/s1 |
InChIKey | AYCPARAPKDAOEN-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1nc2ccsc2c(n1)Nc3c4c([nH]n3)C(N(C4)C(=O)NC(CN(C)C)c5ccccc5)(C)C | OpenEye OEToolkits 2.0.6 | Cc1nc2ccsc2c(n1)Nc3c4c([nH]n3)C(N(C4)C(=O)N[C@H](CN(C)C)c5ccccc5)(C)C | CACTVS 3.385 | CN(C)C[C@@H](NC(=O)N1Cc2c(Nc3nc(C)nc4ccsc34)n[nH]c2C1(C)C)c5ccccc5 | CACTVS 3.385 | CN(C)C[CH](NC(=O)N1Cc2c(Nc3nc(C)nc4ccsc34)n[nH]c2C1(C)C)c5ccccc5 |
|
Formula | C25 H30 N8 O S |
Name | PF-3758309 |
ChEMBL | CHEMBL3128043 |
DrugBank | DB11775 |
ZINC | ZINC000043203531
|
PDB chain | 4o0r Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|