Structure of PDB 4o0j Chain A Binding Site BS01 |
|
|
Ligand ID | LF8 |
InChI | InChI=1S/C27H30ClNO3/c1-15-8-9-20(14-16(15)2)24-17(3)22(19-10-12-21(28)13-11-19)23(18(4)29-24)25(26(30)31)32-27(5,6)7/h8-14,25H,1-7H3,(H,30,31)/t25-/m0/s1 |
InChIKey | DQQCEFPUGHRAEE-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1C)c2c(c(c(c(n2)C)C(C(=O)O)OC(C)(C)C)c3ccc(cc3)Cl)C | ACDLabs 12.01 | O=C(O)C(OC(C)(C)C)c1c(c(c(nc1C)c2ccc(c(c2)C)C)C)c3ccc(Cl)cc3 | CACTVS 3.385 | Cc1ccc(cc1C)c2nc(C)c([C@H](OC(C)(C)C)C(O)=O)c(c2C)c3ccc(Cl)cc3 | CACTVS 3.385 | Cc1ccc(cc1C)c2nc(C)c([CH](OC(C)(C)C)C(O)=O)c(c2C)c3ccc(Cl)cc3 | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1C)c2c(c(c(c(n2)C)[C@@H](C(=O)O)OC(C)(C)C)c3ccc(cc3)Cl)C |
|
Formula | C27 H30 Cl N O3 |
Name | (2S)-tert-butoxy[4-(4-chlorophenyl)-6-(3,4-dimethylphenyl)-2,5-dimethylpyridin-3-yl]ethanoic acid |
ChEMBL | CHEMBL3287924 |
DrugBank | |
ZINC | ZINC000098209107
|
PDB chain | 4o0j Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|