Structure of PDB 4nwc Chain A Binding Site BS01 |
|
|
Ligand ID | 2QE |
InChI | InChI=1S/C9H15NO6/c1-16-7(11)3-2-5(8(12)13)4-6(10)9(14)15/h5-6H,2-4,10H2,1H3,(H,12,13)(H,14,15)/t5-,6+/m1/s1 |
InChIKey | IPTIKQIFOOZKAT-RITPCOANSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COC(=O)CC[C@H](C[C@@H](C(=O)O)N)C(=O)O | CACTVS 3.385 | COC(=O)CC[CH](C[CH](N)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(OC)CCC(C(=O)O)CC(C(=O)O)N | CACTVS 3.385 | COC(=O)CC[C@H](C[C@H](N)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | COC(=O)CCC(CC(C(=O)O)N)C(=O)O |
|
Formula | C9 H15 N O6 |
Name | (2S,4R)-4-(3-Methoxy-3-oxopropyl) glutamic acid; (4R)-4-(3-methoxy-3-oxopropyl)-L-glutamic acid |
ChEMBL | CHEMBL482080 |
DrugBank | |
ZINC | ZINC000040934342
|
PDB chain | 4nwc Chain A Residue 905
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|